C11H16N2O — CID 124537599
[(2R)-6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl]hydrazine (PubChem CID 124537599) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is [(2R)-6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl]hydrazine.
| Compound Name | [(2R)-6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl]hydrazine |
|---|---|
| PubChem CID | 124537599 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | [(2R)-6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl]hydrazine |
| SMILES | COc1ccc2c(c1)CC[C@@H](NN)C2 |
| InChI | InChI=1S/C11H16N2O/c1-14-11-5-3-8-6-10(13-12)4-2-9(8)7-11/h3,5,7,10,13H,2,4,6,12H2,1H3/t10-/m1/s1 |
| InChIKey | LXYHGFHTZBKMCK-SNVBAGLBSA-N |
| XLogP | 1.02 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|