C17H18BrNO — CID 63627261
6-bromo-N-(4-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 63627261) has the molecular formula C17H18BrNO and a molecular weight of 332.24 g/mol. Its IUPAC name is 6-bromo-N-(4-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | 6-bromo-N-(4-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 63627261 |
| Molecular Formula | C17H18BrNO |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 6-bromo-N-(4-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | COc1ccc(NC2CCc3cc(Br)ccc3C2)cc1 |
| InChI | InChI=1S/C17H18BrNO/c1-20-17-8-6-15(7-9-17)19-16-5-3-12-10-14(18)4-2-13(12)11-16/h2,4,6-10,16,19H,3,5,11H2,1H3 |
| InChIKey | UFFWHNNBBMRTLY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|