C17H17BrClNO — CID 63627787
6-bromo-N-(3-chloro-4-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 63627787) has the molecular formula C17H17BrClNO and a molecular weight of 366.69 g/mol. Its IUPAC name is 6-bromo-N-(3-chloro-4-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | 6-bromo-N-(3-chloro-4-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 63627787 |
| Molecular Formula | C17H17BrClNO |
| Molecular Weight | 366.69 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | 6-bromo-N-(3-chloro-4-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | COc1ccc(NC2CCc3cc(Br)ccc3C2)cc1Cl |
| InChI | InChI=1S/C17H17BrClNO/c1-21-17-7-6-15(10-16(17)19)20-14-5-3-11-8-13(18)4-2-12(11)9-14/h2,4,6-8,10,14,20H,3,5,9H2,1H3 |
| InChIKey | UAKMLHNDNKEIAP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.69 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|