C29H35N3O4 — CID 22860528
[4-[5-(5-octoxypyrazin-2-yl)-2-pyridinyl]phenyl] (2R,3R)-3-propyloxirane-2-carboxylate (PubChem CID 22860528) has the molecular formula C29H35N3O4 and a molecular weight of 489.62 g/mol. Its IUPAC name is [4-[5-(5-octoxypyrazin-2-yl)-2-pyridinyl]phenyl] (2R,3R)-3-propyloxirane-2-carboxylate.
| Compound Name | [4-[5-(5-octoxypyrazin-2-yl)-2-pyridinyl]phenyl] (2R,3R)-3-propyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 22860528 |
| Molecular Formula | C29H35N3O4 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | [4-[5-(5-octoxypyrazin-2-yl)-2-pyridinyl]phenyl] (2R,3R)-3-propyloxirane-2-carboxylate |
| SMILES | CCCCCCCCOc1cnc(-c2ccc(-c3ccc(OC(=O)[C@@H]4O[C@@H]4CCC)cc3)nc2)cn1 |
| InChI | InChI=1S/C29H35N3O4/c1-3-5-6-7-8-9-17-34-27-20-31-25(19-32-27)22-13-16-24(30-18-22)21-11-14-23(15-12-21)35-29(33)28-26(36-28)10-4-2/h11-16,18-20,26,28H,3-10,17H2,1-2H3/t26-,28-/m1/s1 |
| InChIKey | VUDVIDNKJWZWQE-IXCJQBJRSA-N |
| XLogP | 6.42 |
| TPSA | 86.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|