C17H14F10O2 — CID 18650009
(4-fluorophenyl) 4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclohexane-1-carboxylate (PubChem CID 18650009) has the molecular formula C17H14F10O2 and a molecular weight of 440.28 g/mol. Its IUPAC name is (4-fluorophenyl) 4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclohexane-1-carboxylate.
| Compound Name | (4-fluorophenyl) 4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 18650009 |
| Molecular Formula | C17H14F10O2 |
| Molecular Weight | 440.28 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | (4-fluorophenyl) 4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclohexane-1-carboxylate |
| SMILES | O=C(Oc1ccc(F)cc1)C1CCC(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H14F10O2/c18-11-5-7-12(8-6-11)29-13(28)9-1-3-10(4-2-9)14(19,20)15(21,22)16(23,24)17(25,26)27/h5-10H,1-4H2 |
| InChIKey | ZBWHGIIJGWFYJJ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.28 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|