C31H43F3O3 — CID 122502291
(4-fluorophenyl) 4-[difluoro-[4-[(E)-2-(4-propylcyclohexyl)ethenyl]cyclohexyl]methoxy]cyclohexane-1-carboxylate (PubChem CID 122502291) has the molecular formula C31H43F3O3 and a molecular weight of 520.68 g/mol. Its IUPAC name is (4-fluorophenyl) 4-[difluoro-[4-[(E)-2-(4-propylcyclohexyl)ethenyl]cyclohexyl]methoxy]cyclohexane-1-carboxylate.
| Compound Name | (4-fluorophenyl) 4-[difluoro-[4-[(E)-2-(4-propylcyclohexyl)ethenyl]cyclohexyl]methoxy]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 122502291 |
| Molecular Formula | C31H43F3O3 |
| Molecular Weight | 520.68 g/mol |
| Exact Mass | 520.32 |
| IUPAC Name | (4-fluorophenyl) 4-[difluoro-[4-[(E)-2-(4-propylcyclohexyl)ethenyl]cyclohexyl]methoxy]cyclohexane-1-carboxylate |
| SMILES | CCCC1CCC(/C=C/C2CCC(C(F)(F)OC3CCC(C(=O)Oc4ccc(F)cc4)CC3)CC2)CC1 |
| InChI | InChI=1S/C31H43F3O3/c1-2-3-22-4-6-23(7-5-22)8-9-24-10-14-26(15-11-24)31(33,34)37-29-18-12-25(13-19-29)30(35)36-28-20-16-27(32)17-21-28/h8-9,16-17,20-26,29H,2-7,10-15,18-19H2,1H3/b9-8+ |
| InChIKey | HKESJTVFRIYKLL-CMDGGOBGSA-N |
| XLogP | 8.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.68 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|