C25H35FO2 — CID 67806421
(4-fluorophenyl) 4-[4-[(E)-hex-1-enyl]cyclohexyl]cyclohexane-1-carboxylate (PubChem CID 67806421) has the molecular formula C25H35FO2 and a molecular weight of 386.55 g/mol. Its IUPAC name is (4-fluorophenyl) 4-[4-[(E)-hex-1-enyl]cyclohexyl]cyclohexane-1-carboxylate.
| Compound Name | (4-fluorophenyl) 4-[4-[(E)-hex-1-enyl]cyclohexyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 67806421 |
| Molecular Formula | C25H35FO2 |
| Molecular Weight | 386.55 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | (4-fluorophenyl) 4-[4-[(E)-hex-1-enyl]cyclohexyl]cyclohexane-1-carboxylate |
| SMILES | CCCC/C=C/C1CCC(C2CCC(C(=O)Oc3ccc(F)cc3)CC2)CC1 |
| InChI | InChI=1S/C25H35FO2/c1-2-3-4-5-6-19-7-9-20(10-8-19)21-11-13-22(14-12-21)25(27)28-24-17-15-23(26)16-18-24/h5-6,15-22H,2-4,7-14H2,1H3/b6-5+ |
| InChIKey | DGULIBCIKNNEHG-AATRIKPKSA-N |
| XLogP | 7.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.55 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|