C29H43F3O3 — CID 118316592
(2,3-difluoro-4-heptoxyphenyl) 4-[(Z)-9-fluoronon-1-enyl]cyclohexane-1-carboxylate (PubChem CID 118316592) has the molecular formula C29H43F3O3 and a molecular weight of 496.65 g/mol. Its IUPAC name is (2,3-difluoro-4-heptoxyphenyl) 4-[(Z)-9-fluoronon-1-enyl]cyclohexane-1-carboxylate.
| Compound Name | (2,3-difluoro-4-heptoxyphenyl) 4-[(Z)-9-fluoronon-1-enyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 118316592 |
| Molecular Formula | C29H43F3O3 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | (2,3-difluoro-4-heptoxyphenyl) 4-[(Z)-9-fluoronon-1-enyl]cyclohexane-1-carboxylate |
| SMILES | CCCCCCCOc1ccc(OC(=O)C2CCC(/C=C\CCCCCCCF)CC2)c(F)c1F |
| InChI | InChI=1S/C29H43F3O3/c1-2-3-4-10-13-22-34-25-19-20-26(28(32)27(25)31)35-29(33)24-17-15-23(16-18-24)14-11-8-6-5-7-9-12-21-30/h11,14,19-20,23-24H,2-10,12-13,15-18,21-22H2,1H3/b14-11- |
| InChIKey | OMKFIDUXOYJVRR-KAMYIIQDSA-N |
| XLogP | 8.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|