C37H52F2O3 — CID 54225781
[4-[4-(4-pentylcyclohexyl)but-3-enyl]phenyl] 2,3-difluoro-4-nonoxybenzoate (PubChem CID 54225781) has the molecular formula C37H52F2O3 and a molecular weight of 582.82 g/mol. Its IUPAC name is [4-[4-(4-pentylcyclohexyl)but-3-enyl]phenyl] 2,3-difluoro-4-nonoxybenzoate.
| Compound Name | [4-[4-(4-pentylcyclohexyl)but-3-enyl]phenyl] 2,3-difluoro-4-nonoxybenzoate |
|---|---|
| PubChem CID | 54225781 |
| Molecular Formula | C37H52F2O3 |
| Molecular Weight | 582.82 g/mol |
| Exact Mass | 582.39 |
| IUPAC Name | [4-[4-(4-pentylcyclohexyl)but-3-enyl]phenyl] 2,3-difluoro-4-nonoxybenzoate |
| SMILES | CCCCCCCCCOc1ccc(C(=O)Oc2ccc(CCC=CC3CCC(CCCCC)CC3)cc2)c(F)c1F |
| InChI | InChI=1S/C37H52F2O3/c1-3-5-7-8-9-10-14-28-41-34-27-26-33(35(38)36(34)39)37(40)42-32-24-22-31(23-25-32)17-13-12-16-30-20-18-29(19-21-30)15-11-6-4-2/h12,16,22-27,29-30H,3-11,13-15,17-21,28H2,1-2H3 |
| InChIKey | QFTMCHGBIOCNSB-UHFFFAOYSA-N |
| XLogP | 11.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.82 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|