C30H40F2O2 — CID 139775833
(4-pentylphenyl) 4-[2-(4-butylcyclohexyl)ethyl]-2,3-difluorobenzoate (PubChem CID 139775833) has the molecular formula C30H40F2O2 and a molecular weight of 470.64 g/mol. Its IUPAC name is (4-pentylphenyl) 4-[2-(4-butylcyclohexyl)ethyl]-2,3-difluorobenzoate.
| Compound Name | (4-pentylphenyl) 4-[2-(4-butylcyclohexyl)ethyl]-2,3-difluorobenzoate |
|---|---|
| PubChem CID | 139775833 |
| Molecular Formula | C30H40F2O2 |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | (4-pentylphenyl) 4-[2-(4-butylcyclohexyl)ethyl]-2,3-difluorobenzoate |
| SMILES | CCCCCc1ccc(OC(=O)c2ccc(CCC3CCC(CCCC)CC3)c(F)c2F)cc1 |
| InChI | InChI=1S/C30H40F2O2/c1-3-5-7-9-23-15-19-26(20-16-23)34-30(33)27-21-18-25(28(31)29(27)32)17-14-24-12-10-22(11-13-24)8-6-4-2/h15-16,18-22,24H,3-14,17H2,1-2H3 |
| InChIKey | DVJXPJWJQUJKSR-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|