C27H32F2O2 — CID 19103534
(4-propylphenyl) 2,3-difluoro-4-(4-pentylcyclohexen-1-yl)benzoate (PubChem CID 19103534) has the molecular formula C27H32F2O2 and a molecular weight of 426.55 g/mol. Its IUPAC name is (4-propylphenyl) 2,3-difluoro-4-(4-pentylcyclohexen-1-yl)benzoate.
| Compound Name | (4-propylphenyl) 2,3-difluoro-4-(4-pentylcyclohexen-1-yl)benzoate |
|---|---|
| PubChem CID | 19103534 |
| Molecular Formula | C27H32F2O2 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | (4-propylphenyl) 2,3-difluoro-4-(4-pentylcyclohexen-1-yl)benzoate |
| SMILES | CCCCCC1CC=C(c2ccc(C(=O)Oc3ccc(CCC)cc3)c(F)c2F)CC1 |
| InChI | InChI=1S/C27H32F2O2/c1-3-5-6-8-20-9-13-21(14-10-20)23-17-18-24(26(29)25(23)28)27(30)31-22-15-11-19(7-4-2)12-16-22/h11-13,15-18,20H,3-10,14H2,1-2H3 |
| InChIKey | HBLDXJMWPGTYEN-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|