C24H28ClFO — CID 59257432
3-chloro-2-fluoro-1-(4-methoxyphenyl)-4-(4-pentylcyclohexen-1-yl)benzene (PubChem CID 59257432) has the molecular formula C24H28ClFO and a molecular weight of 386.94 g/mol. Its IUPAC name is 3-chloro-2-fluoro-1-(4-methoxyphenyl)-4-(4-pentylcyclohexen-1-yl)benzene.
| Compound Name | 3-chloro-2-fluoro-1-(4-methoxyphenyl)-4-(4-pentylcyclohexen-1-yl)benzene |
|---|---|
| PubChem CID | 59257432 |
| Molecular Formula | C24H28ClFO |
| Molecular Weight | 386.94 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 3-chloro-2-fluoro-1-(4-methoxyphenyl)-4-(4-pentylcyclohexen-1-yl)benzene |
| SMILES | CCCCCC1CC=C(c2ccc(-c3ccc(OC)cc3)c(F)c2Cl)CC1 |
| InChI | InChI=1S/C24H28ClFO/c1-3-4-5-6-17-7-9-18(10-8-17)21-15-16-22(24(26)23(21)25)19-11-13-20(27-2)14-12-19/h9,11-17H,3-8,10H2,1-2H3 |
| InChIKey | BAOADFXXYOFOBJ-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.94 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|