C20H28ClFO — CID 59257444
2-chloro-3-fluoro-1-(4-heptylcyclohexen-1-yl)-4-methoxybenzene (PubChem CID 59257444) has the molecular formula C20H28ClFO and a molecular weight of 338.89 g/mol. Its IUPAC name is 2-chloro-3-fluoro-1-(4-heptylcyclohexen-1-yl)-4-methoxybenzene.
| Compound Name | 2-chloro-3-fluoro-1-(4-heptylcyclohexen-1-yl)-4-methoxybenzene |
|---|---|
| PubChem CID | 59257444 |
| Molecular Formula | C20H28ClFO |
| Molecular Weight | 338.89 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 2-chloro-3-fluoro-1-(4-heptylcyclohexen-1-yl)-4-methoxybenzene |
| SMILES | CCCCCCCC1CC=C(c2ccc(OC)c(F)c2Cl)CC1 |
| InChI | InChI=1S/C20H28ClFO/c1-3-4-5-6-7-8-15-9-11-16(12-10-15)17-13-14-18(23-2)20(22)19(17)21/h11,13-15H,3-10,12H2,1-2H3 |
| InChIKey | YGPVWGUJPXDHLI-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.89 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|