C24H26ClFO — CID 59256967
3-chloro-2-fluoro-1-methoxy-4-[4-[4-[(E)-pent-3-enyl]cyclohexen-1-yl]phenyl]benzene (PubChem CID 59256967) has the molecular formula C24H26ClFO and a molecular weight of 384.92 g/mol. Its IUPAC name is 3-chloro-2-fluoro-1-methoxy-4-[4-[4-[(E)-pent-3-enyl]cyclohexen-1-yl]phenyl]benzene.
| Compound Name | 3-chloro-2-fluoro-1-methoxy-4-[4-[4-[(E)-pent-3-enyl]cyclohexen-1-yl]phenyl]benzene |
|---|---|
| PubChem CID | 59256967 |
| Molecular Formula | C24H26ClFO |
| Molecular Weight | 384.92 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 3-chloro-2-fluoro-1-methoxy-4-[4-[4-[(E)-pent-3-enyl]cyclohexen-1-yl]phenyl]benzene |
| SMILES | C/C=C/CCC1CC=C(c2ccc(-c3ccc(OC)c(F)c3Cl)cc2)CC1 |
| InChI | InChI=1S/C24H26ClFO/c1-3-4-5-6-17-7-9-18(10-8-17)19-11-13-20(14-12-19)21-15-16-22(27-2)24(26)23(21)25/h3-4,9,11-17H,5-8,10H2,1-2H3/b4-3+ |
| InChIKey | YMRYZOGHEKDLER-ONEGZZNKSA-N |
| XLogP | 7.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.92 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|