C17H22F2 — CID 14495643
1,2-difluoro-3-(4-pentylcyclohexen-1-yl)benzene (PubChem CID 14495643) has the molecular formula C17H22F2 and a molecular weight of 264.36 g/mol. Its IUPAC name is 1,2-difluoro-3-(4-pentylcyclohexen-1-yl)benzene.
| Compound Name | 1,2-difluoro-3-(4-pentylcyclohexen-1-yl)benzene |
|---|---|
| PubChem CID | 14495643 |
| Molecular Formula | C17H22F2 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 1,2-difluoro-3-(4-pentylcyclohexen-1-yl)benzene |
| SMILES | CCCCCC1CC=C(c2cccc(F)c2F)CC1 |
| InChI | InChI=1S/C17H22F2/c1-2-3-4-6-13-9-11-14(12-10-13)15-7-5-8-16(18)17(15)19/h5,7-8,11,13H,2-4,6,9-10,12H2,1H3 |
| InChIKey | CJQKISQXCNVKNG-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|