C24H34ClFO — CID 59257345
3-chloro-2-fluoro-1-methoxy-4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]benzene (PubChem CID 59257345) has the molecular formula C24H34ClFO and a molecular weight of 392.99 g/mol. Its IUPAC name is 3-chloro-2-fluoro-1-methoxy-4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]benzene.
| Compound Name | 3-chloro-2-fluoro-1-methoxy-4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]benzene |
|---|---|
| PubChem CID | 59257345 |
| Molecular Formula | C24H34ClFO |
| Molecular Weight | 392.99 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 3-chloro-2-fluoro-1-methoxy-4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]benzene |
| SMILES | CCCCCC1CCC(C2CC=C(c3ccc(OC)c(F)c3Cl)CC2)CC1 |
| InChI | InChI=1S/C24H34ClFO/c1-3-4-5-6-17-7-9-18(10-8-17)19-11-13-20(14-12-19)21-15-16-22(27-2)24(26)23(21)25/h13,15-19H,3-12,14H2,1-2H3 |
| InChIKey | ZFWHTGFSEXCUDI-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.99 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|