C25H33F5O — CID 175685847
2,3-difluoro-1-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]-4-(2,2,2-trifluoroethoxy)benzene (PubChem CID 175685847) has the molecular formula C25H33F5O and a molecular weight of 444.53 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]-4-(2,2,2-trifluoroethoxy)benzene.
| Compound Name | 2,3-difluoro-1-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]-4-(2,2,2-trifluoroethoxy)benzene |
|---|---|
| PubChem CID | 175685847 |
| Molecular Formula | C25H33F5O |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 2,3-difluoro-1-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]-4-(2,2,2-trifluoroethoxy)benzene |
| SMILES | CCCCCC1CCC(C2CC=C(c3ccc(OCC(F)(F)F)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C25H33F5O/c1-2-3-4-5-17-6-8-18(9-7-17)19-10-12-20(13-11-19)21-14-15-22(24(27)23(21)26)31-16-25(28,29)30/h12,14-15,17-19H,2-11,13,16H2,1H3 |
| InChIKey | RXZVLVKQMKJRPA-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|