C25H30ClF — CID 59257383
3-chloro-1-(4-ethylcyclohexen-1-yl)-2-fluoro-4-(4-pentylphenyl)benzene (PubChem CID 59257383) has the molecular formula C25H30ClF and a molecular weight of 384.97 g/mol. Its IUPAC name is 3-chloro-1-(4-ethylcyclohexen-1-yl)-2-fluoro-4-(4-pentylphenyl)benzene.
| Compound Name | 3-chloro-1-(4-ethylcyclohexen-1-yl)-2-fluoro-4-(4-pentylphenyl)benzene |
|---|---|
| PubChem CID | 59257383 |
| Molecular Formula | C25H30ClF |
| Molecular Weight | 384.97 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 3-chloro-1-(4-ethylcyclohexen-1-yl)-2-fluoro-4-(4-pentylphenyl)benzene |
| SMILES | CCCCCc1ccc(-c2ccc(C3=CCC(CC)CC3)c(F)c2Cl)cc1 |
| InChI | InChI=1S/C25H30ClF/c1-3-5-6-7-19-10-14-20(15-11-19)22-16-17-23(25(27)24(22)26)21-12-8-18(4-2)9-13-21/h10-12,14-18H,3-9,13H2,1-2H3 |
| InChIKey | PVKUCCUZWBEUSM-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.97 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|