C27H26F8O3 — CID 20576327
[4-[difluoro-(4-pentylcyclohexen-1-yl)oxymethyl]-2,3-difluorophenyl] 4-(1,1-difluoroethyl)-2,3-difluorobenzoate (PubChem CID 20576327) has the molecular formula C27H26F8O3 and a molecular weight of 550.49 g/mol. Its IUPAC name is [4-[difluoro-(4-pentylcyclohexen-1-yl)oxymethyl]-2,3-difluorophenyl] 4-(1,1-difluoroethyl)-2,3-difluorobenzoate.
| Compound Name | [4-[difluoro-(4-pentylcyclohexen-1-yl)oxymethyl]-2,3-difluorophenyl] 4-(1,1-difluoroethyl)-2,3-difluorobenzoate |
|---|---|
| PubChem CID | 20576327 |
| Molecular Formula | C27H26F8O3 |
| Molecular Weight | 550.49 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | [4-[difluoro-(4-pentylcyclohexen-1-yl)oxymethyl]-2,3-difluorophenyl] 4-(1,1-difluoroethyl)-2,3-difluorobenzoate |
| SMILES | CCCCCC1CC=C(OC(F)(F)c2ccc(OC(=O)c3ccc(C(C)(F)F)c(F)c3F)c(F)c2F)CC1 |
| InChI | InChI=1S/C27H26F8O3/c1-3-4-5-6-15-7-9-16(10-8-15)38-27(34,35)19-13-14-20(24(31)23(19)30)37-25(36)17-11-12-18(26(2,32)33)22(29)21(17)28/h9,11-15H,3-8,10H2,1-2H3 |
| InChIKey | XFAUKTLQPSXMIG-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.49 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|