C36H50F2O3 — CID 67857218
[4-[1-(4-pentylcyclohexyl)but-3-enyl]phenyl] 2,3-difluoro-4-octoxybenzoate (PubChem CID 67857218) has the molecular formula C36H50F2O3 and a molecular weight of 568.79 g/mol. Its IUPAC name is [4-[1-(4-pentylcyclohexyl)but-3-enyl]phenyl] 2,3-difluoro-4-octoxybenzoate.
| Compound Name | [4-[1-(4-pentylcyclohexyl)but-3-enyl]phenyl] 2,3-difluoro-4-octoxybenzoate |
|---|---|
| PubChem CID | 67857218 |
| Molecular Formula | C36H50F2O3 |
| Molecular Weight | 568.79 g/mol |
| Exact Mass | 568.37 |
| IUPAC Name | [4-[1-(4-pentylcyclohexyl)but-3-enyl]phenyl] 2,3-difluoro-4-octoxybenzoate |
| SMILES | C=CCC(c1ccc(OC(=O)c2ccc(OCCCCCCCC)c(F)c2F)cc1)C1CCC(CCCCC)CC1 |
| InChI | InChI=1S/C36H50F2O3/c1-4-7-9-10-11-13-26-40-33-25-24-32(34(37)35(33)38)36(39)41-30-22-20-29(21-23-30)31(14-6-3)28-18-16-27(17-19-28)15-12-8-5-2/h6,20-25,27-28,31H,3-5,7-19,26H2,1-2H3 |
| InChIKey | QFOZYMDXHXGURH-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.79 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|