C22H32O2 — CID 19767116
4-[1-(4-pentylcyclohexyl)but-3-enyl]benzoic acid (PubChem CID 19767116) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is 4-[1-(4-pentylcyclohexyl)but-3-enyl]benzoic acid.
| Compound Name | 4-[1-(4-pentylcyclohexyl)but-3-enyl]benzoic acid |
|---|---|
| PubChem CID | 19767116 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | 4-[1-(4-pentylcyclohexyl)but-3-enyl]benzoic acid |
| SMILES | C=CCC(c1ccc(C(=O)O)cc1)C1CCC(CCCCC)CC1 |
| InChI | InChI=1S/C22H32O2/c1-3-5-6-8-17-9-11-18(12-10-17)21(7-4-2)19-13-15-20(16-14-19)22(23)24/h4,13-18,21H,2-3,5-12H2,1H3,(H,23,24) |
| InChIKey | MRQLFQFUBDTSCN-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|