C21H30F2 — CID 19767183
1,2-difluoro-4-[1-(4-pentylcyclohexyl)but-3-enyl]benzene (PubChem CID 19767183) has the molecular formula C21H30F2 and a molecular weight of 320.47 g/mol. Its IUPAC name is 1,2-difluoro-4-[1-(4-pentylcyclohexyl)but-3-enyl]benzene.
| Compound Name | 1,2-difluoro-4-[1-(4-pentylcyclohexyl)but-3-enyl]benzene |
|---|---|
| PubChem CID | 19767183 |
| Molecular Formula | C21H30F2 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | 1,2-difluoro-4-[1-(4-pentylcyclohexyl)but-3-enyl]benzene |
| SMILES | C=CCC(c1ccc(F)c(F)c1)C1CCC(CCCCC)CC1 |
| InChI | InChI=1S/C21H30F2/c1-3-5-6-8-16-9-11-17(12-10-16)19(7-4-2)18-13-14-20(22)21(23)15-18/h4,13-17,19H,2-3,5-12H2,1H3 |
| InChIKey | WRAXUZBRMZJQJC-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|