C25H31ClF2 — CID 54366134
2-chloro-4-(3,4-difluorophenyl)-1-[1-(4-pentylcyclohexyl)ethyl]benzene (PubChem CID 54366134) has the molecular formula C25H31ClF2 and a molecular weight of 404.97 g/mol. Its IUPAC name is 2-chloro-4-(3,4-difluorophenyl)-1-[1-(4-pentylcyclohexyl)ethyl]benzene.
| Compound Name | 2-chloro-4-(3,4-difluorophenyl)-1-[1-(4-pentylcyclohexyl)ethyl]benzene |
|---|---|
| PubChem CID | 54366134 |
| Molecular Formula | C25H31ClF2 |
| Molecular Weight | 404.97 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 2-chloro-4-(3,4-difluorophenyl)-1-[1-(4-pentylcyclohexyl)ethyl]benzene |
| SMILES | CCCCCC1CCC(C(C)c2ccc(-c3ccc(F)c(F)c3)cc2Cl)CC1 |
| InChI | InChI=1S/C25H31ClF2/c1-3-4-5-6-18-7-9-19(10-8-18)17(2)22-13-11-20(15-23(22)26)21-12-14-24(27)25(28)16-21/h11-19H,3-10H2,1-2H3 |
| InChIKey | UPXICYINQAOUPU-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.97 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|