C25H32F2 — CID 139708761
4-[4-[2-(4-butylcyclohexyl)propyl]phenyl]-1,2-difluorobenzene (PubChem CID 139708761) has the molecular formula C25H32F2 and a molecular weight of 370.53 g/mol. Its IUPAC name is 4-[4-[2-(4-butylcyclohexyl)propyl]phenyl]-1,2-difluorobenzene.
| Compound Name | 4-[4-[2-(4-butylcyclohexyl)propyl]phenyl]-1,2-difluorobenzene |
|---|---|
| PubChem CID | 139708761 |
| Molecular Formula | C25H32F2 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 4-[4-[2-(4-butylcyclohexyl)propyl]phenyl]-1,2-difluorobenzene |
| SMILES | CCCCC1CCC(C(C)Cc2ccc(-c3ccc(F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C25H32F2/c1-3-4-5-19-6-10-21(11-7-19)18(2)16-20-8-12-22(13-9-20)23-14-15-24(26)25(27)17-23/h8-9,12-15,17-19,21H,3-7,10-11,16H2,1-2H3 |
| InChIKey | SSDFUBIPEBJGEN-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |