C27H35N — CID 139708880
4-[4-[2-(4-pentylcyclohexyl)propyl]phenyl]benzonitrile (PubChem CID 139708880) has the molecular formula C27H35N and a molecular weight of 373.58 g/mol. Its IUPAC name is 4-[4-[2-(4-pentylcyclohexyl)propyl]phenyl]benzonitrile.
| Compound Name | 4-[4-[2-(4-pentylcyclohexyl)propyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 139708880 |
| Molecular Formula | C27H35N |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 373.28 |
| IUPAC Name | 4-[4-[2-(4-pentylcyclohexyl)propyl]phenyl]benzonitrile |
| SMILES | CCCCCC1CCC(C(C)Cc2ccc(-c3ccc(C#N)cc3)cc2)CC1 |
| InChI | InChI=1S/C27H35N/c1-3-4-5-6-22-7-13-25(14-8-22)21(2)19-23-9-15-26(16-10-23)27-17-11-24(20-28)12-18-27/h9-12,15-18,21-22,25H,3-8,13-14,19H2,1-2H3 |
| InChIKey | LSJMRRCETFAWFG-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|