C21H27F3O4 — CID 118316591
(4-butoxy-2,3-difluorophenyl) 6-[(Z)-2-fluoropent-1-enyl]oxane-3-carboxylate (PubChem CID 118316591) has the molecular formula C21H27F3O4 and a molecular weight of 400.44 g/mol. Its IUPAC name is (4-butoxy-2,3-difluorophenyl) 6-[(Z)-2-fluoropent-1-enyl]oxane-3-carboxylate.
| Compound Name | (4-butoxy-2,3-difluorophenyl) 6-[(Z)-2-fluoropent-1-enyl]oxane-3-carboxylate |
|---|---|
| PubChem CID | 118316591 |
| Molecular Formula | C21H27F3O4 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | (4-butoxy-2,3-difluorophenyl) 6-[(Z)-2-fluoropent-1-enyl]oxane-3-carboxylate |
| SMILES | CCCCOc1ccc(OC(=O)C2CCC(/C=C(\F)CCC)OC2)c(F)c1F |
| InChI | InChI=1S/C21H27F3O4/c1-3-5-11-26-17-9-10-18(20(24)19(17)23)28-21(25)14-7-8-16(27-13-14)12-15(22)6-4-2/h9-10,12,14,16H,3-8,11,13H2,1-2H3/b15-12- |
| InChIKey | PJEZZTJZSHLAHI-QINSGFPZSA-N |
| XLogP | 5.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|