C24H34F2O3 — CID 89178196
(4-butoxy-2,3-difluorophenyl) 4-pentyl-1,2,3,3a,4,5,6,6a-octahydropentalene-1-carboxylate (PubChem CID 89178196) has the molecular formula C24H34F2O3 and a molecular weight of 408.53 g/mol. Its IUPAC name is (4-butoxy-2,3-difluorophenyl) 4-pentyl-1,2,3,3a,4,5,6,6a-octahydropentalene-1-carboxylate.
| Compound Name | (4-butoxy-2,3-difluorophenyl) 4-pentyl-1,2,3,3a,4,5,6,6a-octahydropentalene-1-carboxylate |
|---|---|
| PubChem CID | 89178196 |
| Molecular Formula | C24H34F2O3 |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | (4-butoxy-2,3-difluorophenyl) 4-pentyl-1,2,3,3a,4,5,6,6a-octahydropentalene-1-carboxylate |
| SMILES | CCCCCC1CCC2C(C(=O)Oc3ccc(OCCCC)c(F)c3F)CCC12 |
| InChI | InChI=1S/C24H34F2O3/c1-3-5-7-8-16-9-10-18-17(16)11-12-19(18)24(27)29-21-14-13-20(22(25)23(21)26)28-15-6-4-2/h13-14,16-19H,3-12,15H2,1-2H3 |
| InChIKey | SJIFNBFXSQLGQI-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|