C16H13ClF4 — CID 20654125
2-[chloro(difluoro)methyl]-1,3-difluoro-5-(4-propylphenyl)benzene (PubChem CID 20654125) has the molecular formula C16H13ClF4 and a molecular weight of 316.73 g/mol. Its IUPAC name is 2-[chloro(difluoro)methyl]-1,3-difluoro-5-(4-propylphenyl)benzene.
| Compound Name | 2-[chloro(difluoro)methyl]-1,3-difluoro-5-(4-propylphenyl)benzene |
|---|---|
| PubChem CID | 20654125 |
| Molecular Formula | C16H13ClF4 |
| Molecular Weight | 316.73 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 2-[chloro(difluoro)methyl]-1,3-difluoro-5-(4-propylphenyl)benzene |
| SMILES | CCCc1ccc(-c2cc(F)c(C(F)(F)Cl)c(F)c2)cc1 |
| InChI | InChI=1S/C16H13ClF4/c1-2-3-10-4-6-11(7-5-10)12-8-13(18)15(14(19)9-12)16(17,20)21/h4-9H,2-3H2,1H3 |
| InChIKey | ICUBGEVWVMZWSK-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.73 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|