C16H14F2O — CID 22561373
2,6-difluoro-4-(4-propylphenyl)benzaldehyde (PubChem CID 22561373) has the molecular formula C16H14F2O and a molecular weight of 260.28 g/mol. Its IUPAC name is 2,6-difluoro-4-(4-propylphenyl)benzaldehyde.
| Compound Name | 2,6-difluoro-4-(4-propylphenyl)benzaldehyde |
|---|---|
| PubChem CID | 22561373 |
| Molecular Formula | C16H14F2O |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 2,6-difluoro-4-(4-propylphenyl)benzaldehyde |
| SMILES | CCCc1ccc(-c2cc(F)c(C=O)c(F)c2)cc1 |
| InChI | InChI=1S/C16H14F2O/c1-2-3-11-4-6-12(7-5-11)13-8-15(17)14(10-19)16(18)9-13/h4-10H,2-3H2,1H3 |
| InChIKey | UFRDNAQOMSKPMZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|