C22H27F3Si — CID 123749784
ethyl-[4-[2-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]cyclohexyl]silane (PubChem CID 123749784) has the molecular formula C22H27F3Si and a molecular weight of 376.54 g/mol. Its IUPAC name is ethyl-[4-[2-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]cyclohexyl]silane.
| Compound Name | ethyl-[4-[2-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]cyclohexyl]silane |
|---|---|
| PubChem CID | 123749784 |
| Molecular Formula | C22H27F3Si |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | ethyl-[4-[2-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]cyclohexyl]silane |
| SMILES | CC[SiH2]C1CCC(CCc2ccc(-c3cc(F)c(F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C22H27F3Si/c1-2-26-19-11-7-16(8-12-19)4-3-15-5-9-17(10-6-15)18-13-20(23)22(25)21(24)14-18/h5-6,9-10,13-14,16,19H,2-4,7-8,11-12,26H2,1H3 |
| InChIKey | NBJCGBFEZXDGHP-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|