C31H35ClF2 — CID 54054903
2-chloro-1,3-difluoro-5-[4-[2-[4-(4-pentylphenyl)cyclohexyl]ethyl]phenyl]benzene (PubChem CID 54054903) has the molecular formula C31H35ClF2 and a molecular weight of 481.07 g/mol. Its IUPAC name is 2-chloro-1,3-difluoro-5-[4-[2-[4-(4-pentylphenyl)cyclohexyl]ethyl]phenyl]benzene.
| Compound Name | 2-chloro-1,3-difluoro-5-[4-[2-[4-(4-pentylphenyl)cyclohexyl]ethyl]phenyl]benzene |
|---|---|
| PubChem CID | 54054903 |
| Molecular Formula | C31H35ClF2 |
| Molecular Weight | 481.07 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | 2-chloro-1,3-difluoro-5-[4-[2-[4-(4-pentylphenyl)cyclohexyl]ethyl]phenyl]benzene |
| SMILES | CCCCCc1ccc(C2CCC(CCc3ccc(-c4cc(F)c(Cl)c(F)c4)cc3)CC2)cc1 |
| InChI | InChI=1S/C31H35ClF2/c1-2-3-4-5-22-8-14-25(15-9-22)26-16-10-23(11-17-26)6-7-24-12-18-27(19-13-24)28-20-29(33)31(32)30(34)21-28/h8-9,12-15,18-21,23,26H,2-7,10-11,16-17H2,1H3 |
| InChIKey | LVNYWIWQJBBUQM-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.07 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|