C30H33F5O2 — CID 139872861
2-[5-fluoro-6-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]naphthalen-2-yl]-5-heptyl-1,3-dioxane (PubChem CID 139872861) has the molecular formula C30H33F5O2 and a molecular weight of 520.58 g/mol. Its IUPAC name is 2-[5-fluoro-6-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]naphthalen-2-yl]-5-heptyl-1,3-dioxane.
| Compound Name | 2-[5-fluoro-6-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]naphthalen-2-yl]-5-heptyl-1,3-dioxane |
|---|---|
| PubChem CID | 139872861 |
| Molecular Formula | C30H33F5O2 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | 2-[5-fluoro-6-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]naphthalen-2-yl]-5-heptyl-1,3-dioxane |
| SMILES | CCCCCCCC1COC(c2ccc3c(F)c(CCc4ccc(C(F)(F)F)c(F)c4)ccc3c2)OC1 |
| InChI | InChI=1S/C30H33F5O2/c1-2-3-4-5-6-7-21-18-36-29(37-19-21)24-13-14-25-23(17-24)12-11-22(28(25)32)10-8-20-9-15-26(27(31)16-20)30(33,34)35/h9,11-17,21,29H,2-8,10,18-19H2,1H3 |
| InChIKey | MILGWADCBDHLQM-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|