C32H29F4N — CID 139871188
2,6-difluoro-4-[2-[1-fluoro-6-[2-(2-fluoro-4-pentylphenyl)ethyl]naphthalen-2-yl]ethyl]benzonitrile (PubChem CID 139871188) has the molecular formula C32H29F4N and a molecular weight of 503.58 g/mol. Its IUPAC name is 2,6-difluoro-4-[2-[1-fluoro-6-[2-(2-fluoro-4-pentylphenyl)ethyl]naphthalen-2-yl]ethyl]benzonitrile.
| Compound Name | 2,6-difluoro-4-[2-[1-fluoro-6-[2-(2-fluoro-4-pentylphenyl)ethyl]naphthalen-2-yl]ethyl]benzonitrile |
|---|---|
| PubChem CID | 139871188 |
| Molecular Formula | C32H29F4N |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 2,6-difluoro-4-[2-[1-fluoro-6-[2-(2-fluoro-4-pentylphenyl)ethyl]naphthalen-2-yl]ethyl]benzonitrile |
| SMILES | CCCCCc1ccc(CCc2ccc3c(F)c(CCc4cc(F)c(C#N)c(F)c4)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C32H29F4N/c1-2-3-4-5-21-6-10-24(29(33)17-21)11-7-22-9-15-27-26(16-22)14-13-25(32(27)36)12-8-23-18-30(34)28(20-37)31(35)19-23/h6,9-10,13-19H,2-5,7-8,11-12H2,1H3 |
| InChIKey | SQOXCYKGCRUGIA-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|