C20H26F2O4 — CID 54553899
5-but-1-enyl-2-[2-[2-(3,4-difluorophenyl)ethyl]-1,3-dioxan-5-yl]-1,3-dioxane (PubChem CID 54553899) has the molecular formula C20H26F2O4 and a molecular weight of 368.42 g/mol. Its IUPAC name is 5-but-1-enyl-2-[2-[2-(3,4-difluorophenyl)ethyl]-1,3-dioxan-5-yl]-1,3-dioxane.
| Compound Name | 5-but-1-enyl-2-[2-[2-(3,4-difluorophenyl)ethyl]-1,3-dioxan-5-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 54553899 |
| Molecular Formula | C20H26F2O4 |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 5-but-1-enyl-2-[2-[2-(3,4-difluorophenyl)ethyl]-1,3-dioxan-5-yl]-1,3-dioxane |
| SMILES | CCC=CC1COC(C2COC(CCc3ccc(F)c(F)c3)OC2)OC1 |
| InChI | InChI=1S/C20H26F2O4/c1-2-3-4-15-10-25-20(26-11-15)16-12-23-19(24-13-16)8-6-14-5-7-17(21)18(22)9-14/h3-5,7,9,15-16,19-20H,2,6,8,10-13H2,1H3 |
| InChIKey | ZLUVALUKFWTZHH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|