C12H14F2O — CID 83936226
2-[2-(3,4-difluorophenyl)ethyl]-3-ethyloxirane (PubChem CID 83936226) has the molecular formula C12H14F2O and a molecular weight of 212.24 g/mol. Its IUPAC name is 2-[2-(3,4-difluorophenyl)ethyl]-3-ethyloxirane.
| Compound Name | 2-[2-(3,4-difluorophenyl)ethyl]-3-ethyloxirane |
|---|---|
| PubChem CID | 83936226 |
| Molecular Formula | C12H14F2O |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2-[2-(3,4-difluorophenyl)ethyl]-3-ethyloxirane |
| SMILES | CCC1OC1CCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H14F2O/c1-2-11-12(15-11)6-4-8-3-5-9(13)10(14)7-8/h3,5,7,11-12H,2,4,6H2,1H3 |
| InChIKey | RORCUYFBSOGGIP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|