C14H18F2O — CID 83936121
2-[2-(2,5-difluorophenyl)butyl]-3-ethyloxirane (PubChem CID 83936121) has the molecular formula C14H18F2O and a molecular weight of 240.29 g/mol. Its IUPAC name is 2-[2-(2,5-difluorophenyl)butyl]-3-ethyloxirane.
| Compound Name | 2-[2-(2,5-difluorophenyl)butyl]-3-ethyloxirane |
|---|---|
| PubChem CID | 83936121 |
| Molecular Formula | C14H18F2O |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 2-[2-(2,5-difluorophenyl)butyl]-3-ethyloxirane |
| SMILES | CCC(CC1OC1CC)c1cc(F)ccc1F |
| InChI | InChI=1S/C14H18F2O/c1-3-9(7-14-13(4-2)17-14)11-8-10(15)5-6-12(11)16/h5-6,8-9,13-14H,3-4,7H2,1-2H3 |
| InChIKey | SINMHBCHCACWNE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|