C18H26O — CID 83931797
2-ethyl-3-[2-(5,6,7,8-tetrahydronaphthalen-2-yl)butyl]oxirane (PubChem CID 83931797) has the molecular formula C18H26O and a molecular weight of 258.40 g/mol. Its IUPAC name is 2-ethyl-3-[2-(5,6,7,8-tetrahydronaphthalen-2-yl)butyl]oxirane.
| Compound Name | 2-ethyl-3-[2-(5,6,7,8-tetrahydronaphthalen-2-yl)butyl]oxirane |
|---|---|
| PubChem CID | 83931797 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 2-ethyl-3-[2-(5,6,7,8-tetrahydronaphthalen-2-yl)butyl]oxirane |
| SMILES | CCC(CC1OC1CC)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C18H26O/c1-3-13(12-18-17(4-2)19-18)16-10-9-14-7-5-6-8-15(14)11-16/h9-11,13,17-18H,3-8,12H2,1-2H3 |
| InChIKey | XTVYMGJEMHVDDK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|