C16H23FO — CID 83931680
2-ethyl-3-[2-(2-fluoro-4,5-dimethylphenyl)butyl]oxirane (PubChem CID 83931680) has the molecular formula C16H23FO and a molecular weight of 250.36 g/mol. Its IUPAC name is 2-ethyl-3-[2-(2-fluoro-4,5-dimethylphenyl)butyl]oxirane.
| Compound Name | 2-ethyl-3-[2-(2-fluoro-4,5-dimethylphenyl)butyl]oxirane |
|---|---|
| PubChem CID | 83931680 |
| Molecular Formula | C16H23FO |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 2-ethyl-3-[2-(2-fluoro-4,5-dimethylphenyl)butyl]oxirane |
| SMILES | CCC(CC1OC1CC)c1cc(C)c(C)cc1F |
| InChI | InChI=1S/C16H23FO/c1-5-12(9-16-15(6-2)18-16)13-7-10(3)11(4)8-14(13)17/h7-8,12,15-16H,5-6,9H2,1-4H3 |
| InChIKey | YFVBJEFRWNVGPR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|