C16H23ClO3 — CID 83943363
2-[2-(5-chloro-2,4-dimethoxyphenyl)butyl]-3-ethyloxirane (PubChem CID 83943363) has the molecular formula C16H23ClO3 and a molecular weight of 298.81 g/mol. Its IUPAC name is 2-[2-(5-chloro-2,4-dimethoxyphenyl)butyl]-3-ethyloxirane.
| Compound Name | 2-[2-(5-chloro-2,4-dimethoxyphenyl)butyl]-3-ethyloxirane |
|---|---|
| PubChem CID | 83943363 |
| Molecular Formula | C16H23ClO3 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 2-[2-(5-chloro-2,4-dimethoxyphenyl)butyl]-3-ethyloxirane |
| SMILES | CCC(CC1OC1CC)c1cc(Cl)c(OC)cc1OC |
| InChI | InChI=1S/C16H23ClO3/c1-5-10(7-16-13(6-2)20-16)11-8-12(17)15(19-4)9-14(11)18-3/h8-10,13,16H,5-7H2,1-4H3 |
| InChIKey | ZSNLKMJMWUJVCV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|