C15H21ClO2 — CID 83943357
1-chloro-5-[(Z)-hept-4-en-2-yl]-2,4-dimethoxybenzene (PubChem CID 83943357) has the molecular formula C15H21ClO2 and a molecular weight of 268.78 g/mol. Its IUPAC name is 1-chloro-5-[(Z)-hept-4-en-2-yl]-2,4-dimethoxybenzene.
| Compound Name | 1-chloro-5-[(Z)-hept-4-en-2-yl]-2,4-dimethoxybenzene |
|---|---|
| PubChem CID | 83943357 |
| Molecular Formula | C15H21ClO2 |
| Molecular Weight | 268.78 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 1-chloro-5-[(Z)-hept-4-en-2-yl]-2,4-dimethoxybenzene |
| SMILES | CC/C=C\CC(C)c1cc(Cl)c(OC)cc1OC |
| InChI | InChI=1S/C15H21ClO2/c1-5-6-7-8-11(2)12-9-13(16)15(18-4)10-14(12)17-3/h6-7,9-11H,5,8H2,1-4H3/b7-6- |
| InChIKey | UFJCXWLJKLCJNV-SREVYHEPSA-N |
| XLogP | 4.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.78 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|