C15H21ClO3 — CID 83943659
2-[2-(2-chloro-4,5-dimethoxyphenyl)butyl]-3-methyloxirane (PubChem CID 83943659) has the molecular formula C15H21ClO3 and a molecular weight of 284.78 g/mol. Its IUPAC name is 2-[2-(2-chloro-4,5-dimethoxyphenyl)butyl]-3-methyloxirane.
| Compound Name | 2-[2-(2-chloro-4,5-dimethoxyphenyl)butyl]-3-methyloxirane |
|---|---|
| PubChem CID | 83943659 |
| Molecular Formula | C15H21ClO3 |
| Molecular Weight | 284.78 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 2-[2-(2-chloro-4,5-dimethoxyphenyl)butyl]-3-methyloxirane |
| SMILES | CCC(CC1OC1C)c1cc(OC)c(OC)cc1Cl |
| InChI | InChI=1S/C15H21ClO3/c1-5-10(6-13-9(2)19-13)11-7-14(17-3)15(18-4)8-12(11)16/h7-10,13H,5-6H2,1-4H3 |
| InChIKey | HDFFIUUPVMAOFU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.78 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|