C18H27ClO2 — CID 83940779
2-[2-(3-chloro-2,5-dimethyl-6-propoxyphenyl)butyl]-3-methyloxirane (PubChem CID 83940779) has the molecular formula C18H27ClO2 and a molecular weight of 310.87 g/mol. Its IUPAC name is 2-[2-(3-chloro-2,5-dimethyl-6-propoxyphenyl)butyl]-3-methyloxirane.
| Compound Name | 2-[2-(3-chloro-2,5-dimethyl-6-propoxyphenyl)butyl]-3-methyloxirane |
|---|---|
| PubChem CID | 83940779 |
| Molecular Formula | C18H27ClO2 |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 2-[2-(3-chloro-2,5-dimethyl-6-propoxyphenyl)butyl]-3-methyloxirane |
| SMILES | CCCOc1c(C)cc(Cl)c(C)c1C(CC)CC1OC1C |
| InChI | InChI=1S/C18H27ClO2/c1-6-8-20-18-11(3)9-15(19)12(4)17(18)14(7-2)10-16-13(5)21-16/h9,13-14,16H,6-8,10H2,1-5H3 |
| InChIKey | YCZOCLRMJSYRDY-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|