C18H27ClO — CID 83940652
1-chloro-4-ethoxy-2,5-dimethyl-3-[(Z)-oct-5-en-3-yl]benzene (PubChem CID 83940652) has the molecular formula C18H27ClO and a molecular weight of 294.87 g/mol. Its IUPAC name is 1-chloro-4-ethoxy-2,5-dimethyl-3-[(Z)-oct-5-en-3-yl]benzene.
| Compound Name | 1-chloro-4-ethoxy-2,5-dimethyl-3-[(Z)-oct-5-en-3-yl]benzene |
|---|---|
| PubChem CID | 83940652 |
| Molecular Formula | C18H27ClO |
| Molecular Weight | 294.87 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 1-chloro-4-ethoxy-2,5-dimethyl-3-[(Z)-oct-5-en-3-yl]benzene |
| SMILES | CC/C=C\CC(CC)c1c(C)c(Cl)cc(C)c1OCC |
| InChI | InChI=1S/C18H27ClO/c1-6-9-10-11-15(7-2)17-14(5)16(19)12-13(4)18(17)20-8-3/h9-10,12,15H,6-8,11H2,1-5H3/b10-9- |
| InChIKey | KETSOMOYBKDTKO-KTKRTIGZSA-N |
| XLogP | 6.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.87 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|