C11H14ClNO2 — CID 82266739
5-chloro-2-ethoxy-3,6-dimethylbenzamide (PubChem CID 82266739) has the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. Its IUPAC name is 5-chloro-2-ethoxy-3,6-dimethylbenzamide.
| Compound Name | 5-chloro-2-ethoxy-3,6-dimethylbenzamide |
|---|---|
| PubChem CID | 82266739 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 5-chloro-2-ethoxy-3,6-dimethylbenzamide |
| SMILES | CCOc1c(C)cc(Cl)c(C)c1C(N)=O |
| InChI | InChI=1S/C11H14ClNO2/c1-4-15-10-6(2)5-8(12)7(3)9(10)11(13)14/h5H,4H2,1-3H3,(H2,13,14) |
| InChIKey | CLBKDDNNCGQJFN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |