C19H30 — CID 83941472
1,2,4,5-tetramethyl-3-[(Z)-non-6-en-4-yl]benzene (PubChem CID 83941472) has the molecular formula C19H30 and a molecular weight of 258.45 g/mol. Its IUPAC name is 1,2,4,5-tetramethyl-3-[(Z)-non-6-en-4-yl]benzene.
| Compound Name | 1,2,4,5-tetramethyl-3-[(Z)-non-6-en-4-yl]benzene |
|---|---|
| PubChem CID | 83941472 |
| Molecular Formula | C19H30 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | 1,2,4,5-tetramethyl-3-[(Z)-non-6-en-4-yl]benzene |
| SMILES | CC/C=C\CC(CCC)c1c(C)c(C)cc(C)c1C |
| InChI | InChI=1S/C19H30/c1-7-9-10-12-18(11-8-2)19-16(5)14(3)13-15(4)17(19)6/h9-10,13,18H,7-8,11-12H2,1-6H3/b10-9- |
| InChIKey | PKCFKRHAARCMKB-KTKRTIGZSA-N |
| XLogP | 6.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|