C21H34O — CID 83942988
1-tert-butyl-2-methoxy-5-methyl-3-[(Z)-non-6-en-4-yl]benzene (PubChem CID 83942988) has the molecular formula C21H34O and a molecular weight of 302.50 g/mol. Its IUPAC name is 1-tert-butyl-2-methoxy-5-methyl-3-[(Z)-non-6-en-4-yl]benzene.
| Compound Name | 1-tert-butyl-2-methoxy-5-methyl-3-[(Z)-non-6-en-4-yl]benzene |
|---|---|
| PubChem CID | 83942988 |
| Molecular Formula | C21H34O |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | 1-tert-butyl-2-methoxy-5-methyl-3-[(Z)-non-6-en-4-yl]benzene |
| SMILES | CC/C=C\CC(CCC)c1cc(C)cc(C(C)(C)C)c1OC |
| InChI | InChI=1S/C21H34O/c1-8-10-11-13-17(12-9-2)18-14-16(3)15-19(20(18)22-7)21(4,5)6/h10-11,14-15,17H,8-9,12-13H2,1-7H3/b11-10- |
| InChIKey | AAIZXKDIBATYAJ-KHPPLWFESA-N |
| XLogP | 6.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|