C20H32O2 — CID 83942992
2-[2-(3-tert-butyl-2-methoxy-5-methylphenyl)butyl]-3-ethyloxirane (PubChem CID 83942992) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is 2-[2-(3-tert-butyl-2-methoxy-5-methylphenyl)butyl]-3-ethyloxirane.
| Compound Name | 2-[2-(3-tert-butyl-2-methoxy-5-methylphenyl)butyl]-3-ethyloxirane |
|---|---|
| PubChem CID | 83942992 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 2-[2-(3-tert-butyl-2-methoxy-5-methylphenyl)butyl]-3-ethyloxirane |
| SMILES | CCC(CC1OC1CC)c1cc(C)cc(C(C)(C)C)c1OC |
| InChI | InChI=1S/C20H32O2/c1-8-14(12-18-17(9-2)22-18)15-10-13(3)11-16(19(15)21-7)20(4,5)6/h10-11,14,17-18H,8-9,12H2,1-7H3 |
| InChIKey | PNBRZWMTVVLYKJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|