C17H23F3O2 — CID 83921243
2-[2-[2-ethoxy-5-(trifluoromethyl)phenyl]butyl]-3-ethyloxirane (PubChem CID 83921243) has the molecular formula C17H23F3O2 and a molecular weight of 316.36 g/mol. Its IUPAC name is 2-[2-[2-ethoxy-5-(trifluoromethyl)phenyl]butyl]-3-ethyloxirane.
| Compound Name | 2-[2-[2-ethoxy-5-(trifluoromethyl)phenyl]butyl]-3-ethyloxirane |
|---|---|
| PubChem CID | 83921243 |
| Molecular Formula | C17H23F3O2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 2-[2-[2-ethoxy-5-(trifluoromethyl)phenyl]butyl]-3-ethyloxirane |
| SMILES | CCOc1ccc(C(F)(F)F)cc1C(CC)CC1OC1CC |
| InChI | InChI=1S/C17H23F3O2/c1-4-11(9-16-14(5-2)22-16)13-10-12(17(18,19)20)7-8-15(13)21-6-3/h7-8,10-11,14,16H,4-6,9H2,1-3H3 |
| InChIKey | LPLWJYYSJIQCSC-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|