C16H19F3O3 — CID 83921148
2-[2-[2-methoxy-5-(trifluoromethyl)phenyl]butyl]cyclopropane-1-carboxylic acid (PubChem CID 83921148) has the molecular formula C16H19F3O3 and a molecular weight of 316.32 g/mol. Its IUPAC name is 2-[2-[2-methoxy-5-(trifluoromethyl)phenyl]butyl]cyclopropane-1-carboxylic acid.
| Compound Name | 2-[2-[2-methoxy-5-(trifluoromethyl)phenyl]butyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 83921148 |
| Molecular Formula | C16H19F3O3 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 2-[2-[2-methoxy-5-(trifluoromethyl)phenyl]butyl]cyclopropane-1-carboxylic acid |
| SMILES | CCC(CC1CC1C(=O)O)c1cc(C(F)(F)F)ccc1OC |
| InChI | InChI=1S/C16H19F3O3/c1-3-9(6-10-7-13(10)15(20)21)12-8-11(16(17,18)19)4-5-14(12)22-2/h4-5,8-10,13H,3,6-7H2,1-2H3,(H,20,21) |
| InChIKey | KBAKAOPXLWOJGG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |