C15H17F3O3 — CID 83921264
2-[2-[2-ethoxy-5-(trifluoromethyl)phenyl]ethyl]cyclopropane-1-carboxylic acid (PubChem CID 83921264) has the molecular formula C15H17F3O3 and a molecular weight of 302.29 g/mol. Its IUPAC name is 2-[2-[2-ethoxy-5-(trifluoromethyl)phenyl]ethyl]cyclopropane-1-carboxylic acid.
| Compound Name | 2-[2-[2-ethoxy-5-(trifluoromethyl)phenyl]ethyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 83921264 |
| Molecular Formula | C15H17F3O3 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-[2-[2-ethoxy-5-(trifluoromethyl)phenyl]ethyl]cyclopropane-1-carboxylic acid |
| SMILES | CCOc1ccc(C(F)(F)F)cc1CCC1CC1C(=O)O |
| InChI | InChI=1S/C15H17F3O3/c1-2-21-13-6-5-11(15(16,17)18)7-10(13)4-3-9-8-12(9)14(19)20/h5-7,9,12H,2-4,8H2,1H3,(H,19,20) |
| InChIKey | SMZWEELCKYWIFY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |